C16H22N6O3 — CID 156851567
1-[2-[(2-amino-2-oxoethyl)amino]acetyl]-N-[(4-carbamimidoylphenyl)methyl]azetidine-2-carboxamide (PubChem CID 156851567) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-[2-[(2-amino-2-oxoethyl)amino]acetyl]-N-[(4-carbamimidoylphenyl)methyl]azetidine-2-carboxamide.
| Compound Name | 1-[2-[(2-amino-2-oxoethyl)amino]acetyl]-N-[(4-carbamimidoylphenyl)methyl]azetidine-2-carboxamide |
|---|---|
| PubChem CID | 156851567 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[2-[(2-amino-2-oxoethyl)amino]acetyl]-N-[(4-carbamimidoylphenyl)methyl]azetidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C2CCN2C(=O)CNCC(N)=O)cc1 |
| InChI | InChI=1S/C16H22N6O3/c17-13(23)8-20-9-14(24)22-6-5-12(22)16(25)21-7-10-1-3-11(4-2-10)15(18)19/h1-4,12,20H,5-9H2,(H2,17,23)(H3,18,19)(H,21,25) |
| InChIKey | LXTXONHBHPKEGM-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 154.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|