C26H30N4O4 — CID 149011559
(4R)-5-[(2S)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]azetidin-1-yl]-4-(2,3-dihydro-1H-inden-2-yl)-5-oxopentanoic acid (PubChem CID 149011559) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is (4R)-5-[(2S)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]azetidin-1-yl]-4-(2,3-dihydro-1H-inden-2-yl)-5-oxopentanoic acid.
| Compound Name | (4R)-5-[(2S)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]azetidin-1-yl]-4-(2,3-dihydro-1H-inden-2-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 149011559 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (4R)-5-[(2S)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]azetidin-1-yl]-4-(2,3-dihydro-1H-inden-2-yl)-5-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2CCN2C(=O)[C@H](CCC(=O)O)C2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C26H30N4O4/c27-24(28)17-7-5-16(6-8-17)15-29-25(33)22-11-12-30(22)26(34)21(9-10-23(31)32)20-13-18-3-1-2-4-19(18)14-20/h1-8,20-22H,9-15H2,(H3,27,28)(H,29,33)(H,31,32)/t21-,22+/m1/s1 |
| InChIKey | QBQDCRKNGKVNTL-YADHBBJMSA-N |
| XLogP | 2.08 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|