C21H33N5O — CID 118736287
(2S)-1-[(2R)-2-amino-2-cyclohexylethyl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 118736287) has the molecular formula C21H33N5O and a molecular weight of 371.53 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-amino-2-cyclohexylethyl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-2-amino-2-cyclohexylethyl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118736287 |
| Molecular Formula | C21H33N5O |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | (2S)-1-[(2R)-2-amino-2-cyclohexylethyl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2CCCN2C[C@H](N)C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H33N5O/c22-18(16-5-2-1-3-6-16)14-26-12-4-7-19(26)21(27)25-13-15-8-10-17(11-9-15)20(23)24/h8-11,16,18-19H,1-7,12-14,22H2,(H3,23,24)(H,25,27)/t18-,19-/m0/s1 |
| InChIKey | BSTHZOIXFUYPNJ-OALUTQOASA-N |
| XLogP | 1.96 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|