C19H32ClN5O — CID 118736284
(2S)-1-[(2R)-2-amino-4-methylpentyl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 118736284) has the molecular formula C19H32ClN5O and a molecular weight of 381.95 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-amino-4-methylpentyl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-1-[(2R)-2-amino-4-methylpentyl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 118736284 |
| Molecular Formula | C19H32ClN5O |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (2S)-1-[(2R)-2-amino-4-methylpentyl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2CCCN2C[C@H](N)CC(C)C)cc1 |
| InChI | InChI=1S/C19H31N5O.ClH/c1-13(2)10-16(20)12-24-9-3-4-17(24)19(25)23-11-14-5-7-15(8-6-14)18(21)22;/h5-8,13,16-17H,3-4,9-12,20H2,1-2H3,(H3,21,22)(H,23,25);1H/t16-,17+;/m1./s1 |
| InChIKey | LCDLLZBEFYCCBV-PPPUBMIESA-N |
| XLogP | 1.85 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|