C26H35N5O4S — CID 71481986
(2S)-N-[(4-carbamimidoylphenyl)methyl]-1-[2-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carboxamide (PubChem CID 71481986) has the molecular formula C26H35N5O4S and a molecular weight of 513.66 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-1-[2-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-1-[2-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71481986 |
| Molecular Formula | C26H35N5O4S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-1-[2-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2CCCN2C(=O)CNS(=O)(=O)c2c(C)c(C)c(C)c(C)c2C)cc1 |
| InChI | InChI=1S/C26H35N5O4S/c1-15-16(2)18(4)24(19(5)17(15)3)36(34,35)30-14-23(32)31-12-6-7-22(31)26(33)29-13-20-8-10-21(11-9-20)25(27)28/h8-11,22,30H,6-7,12-14H2,1-5H3,(H3,27,28)(H,29,33)/t22-/m0/s1 |
| InChIKey | GJFYXBPYFJWYTI-QFIPXVFZSA-N |
| XLogP | 2.10 |
| TPSA | 145.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|