C25H33N5O4S — CID 71482414
(2S)-1-[2-[(4-tert-butylphenyl)sulfonylamino]acetyl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 71482414) has the molecular formula C25H33N5O4S and a molecular weight of 499.64 g/mol. Its IUPAC name is (2S)-1-[2-[(4-tert-butylphenyl)sulfonylamino]acetyl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2-[(4-tert-butylphenyl)sulfonylamino]acetyl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71482414 |
| Molecular Formula | C25H33N5O4S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | (2S)-1-[2-[(4-tert-butylphenyl)sulfonylamino]acetyl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2CCCN2C(=O)CNS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H33N5O4S/c1-25(2,3)19-10-12-20(13-11-19)35(33,34)29-16-22(31)30-14-4-5-21(30)24(32)28-15-17-6-8-18(9-7-17)23(26)27/h6-13,21,29H,4-5,14-16H2,1-3H3,(H3,26,27)(H,28,32)/t21-/m0/s1 |
| InChIKey | LWJWUCGFWQYQEO-NRFANRHFSA-N |
| XLogP | 1.85 |
| TPSA | 145.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|