C23H35N3O5 — CID 174325917
tert-butyl 2-[1-[2-[(4-aminobenzoyl)amino]propanoyl]piperidin-4-yl]-2-ethoxyacetate (PubChem CID 174325917) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl 2-[1-[2-[(4-aminobenzoyl)amino]propanoyl]piperidin-4-yl]-2-ethoxyacetate.
| Compound Name | tert-butyl 2-[1-[2-[(4-aminobenzoyl)amino]propanoyl]piperidin-4-yl]-2-ethoxyacetate |
|---|---|
| PubChem CID | 174325917 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | tert-butyl 2-[1-[2-[(4-aminobenzoyl)amino]propanoyl]piperidin-4-yl]-2-ethoxyacetate |
| SMILES | CCOC(C(=O)OC(C)(C)C)C1CCN(C(=O)C(C)NC(=O)c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C23H35N3O5/c1-6-30-19(22(29)31-23(3,4)5)16-11-13-26(14-12-16)21(28)15(2)25-20(27)17-7-9-18(24)10-8-17/h7-10,15-16,19H,6,11-14,24H2,1-5H3,(H,25,27) |
| InChIKey | XNWOAMNMLFAKBC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|