C22H32N4O6 — CID 167019915
2-[1-[2-[[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]amino]propanoyl]piperidin-4-yl]oxy-3,3-dimethylbutanoic acid (PubChem CID 167019915) has the molecular formula C22H32N4O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[1-[2-[[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]amino]propanoyl]piperidin-4-yl]oxy-3,3-dimethylbutanoic acid.
| Compound Name | 2-[1-[2-[[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]amino]propanoyl]piperidin-4-yl]oxy-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 167019915 |
| Molecular Formula | C22H32N4O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 2-[1-[2-[[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]amino]propanoyl]piperidin-4-yl]oxy-3,3-dimethylbutanoic acid |
| SMILES | CC(NC(=O)c1ccc(/C(N)=N/O)cc1)C(=O)N1CCC(OC(C(=O)O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C22H32N4O6/c1-13(24-19(27)15-7-5-14(6-8-15)18(23)25-31)20(28)26-11-9-16(10-12-26)32-17(21(29)30)22(2,3)4/h5-8,13,16-17,31H,9-12H2,1-4H3,(H2,23,25)(H,24,27)(H,29,30) |
| InChIKey | YUYNOTAEJQNTMT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 154.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|