C20H28N4O6 — CID 174427796
2-[1-[2-[[4-[(Z)-aminooxyiminomethyl]benzoyl]amino]propanoyl]piperidin-4-yl]-2-ethoxyacetic acid (PubChem CID 174427796) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-[1-[2-[[4-[(Z)-aminooxyiminomethyl]benzoyl]amino]propanoyl]piperidin-4-yl]-2-ethoxyacetic acid.
| Compound Name | 2-[1-[2-[[4-[(Z)-aminooxyiminomethyl]benzoyl]amino]propanoyl]piperidin-4-yl]-2-ethoxyacetic acid |
|---|---|
| PubChem CID | 174427796 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[1-[2-[[4-[(Z)-aminooxyiminomethyl]benzoyl]amino]propanoyl]piperidin-4-yl]-2-ethoxyacetic acid |
| SMILES | CCOC(C(=O)O)C1CCN(C(=O)C(C)NC(=O)c2ccc(/C=N\ON)cc2)CC1 |
| InChI | InChI=1S/C20H28N4O6/c1-3-29-17(20(27)28)15-8-10-24(11-9-15)19(26)13(2)23-18(25)16-6-4-14(5-7-16)12-22-30-21/h4-7,12-13,15,17H,3,8-11,21H2,1-2H3,(H,23,25)(H,27,28)/b22-12- |
| InChIKey | VUGISYGEVGWYTF-UUYOSTAYSA-N |
| XLogP | 0.76 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|