C22H31N5O6 — CID 67651063
(2S)-2-[1-[2-[(5-methanehydrazonoylpyridine-2-carbonyl)amino]propanoyl]piperidin-4-yl]oxy-2-(oxan-4-yl)acetic acid (PubChem CID 67651063) has the molecular formula C22H31N5O6 and a molecular weight of 461.52 g/mol. Its IUPAC name is (2S)-2-[1-[2-[(5-methanehydrazonoylpyridine-2-carbonyl)amino]propanoyl]piperidin-4-yl]oxy-2-(oxan-4-yl)acetic acid.
| Compound Name | (2S)-2-[1-[2-[(5-methanehydrazonoylpyridine-2-carbonyl)amino]propanoyl]piperidin-4-yl]oxy-2-(oxan-4-yl)acetic acid |
|---|---|
| PubChem CID | 67651063 |
| Molecular Formula | C22H31N5O6 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (2S)-2-[1-[2-[(5-methanehydrazonoylpyridine-2-carbonyl)amino]propanoyl]piperidin-4-yl]oxy-2-(oxan-4-yl)acetic acid |
| SMILES | CC(NC(=O)c1ccc(C=NN)cn1)C(=O)N1CCC(O[C@H](C(=O)O)C2CCOCC2)CC1 |
| InChI | InChI=1S/C22H31N5O6/c1-14(26-20(28)18-3-2-15(12-24-18)13-25-23)21(29)27-8-4-17(5-9-27)33-19(22(30)31)16-6-10-32-11-7-16/h2-3,12-14,16-17,19H,4-11,23H2,1H3,(H,26,28)(H,30,31)/t14?,19-/m0/s1 |
| InChIKey | YGVWQDPGGCMLHP-PKDNWHCCSA-N |
| XLogP | 0.38 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|