C17H23N5O5 — CID 54419296
2-[1-[(2S)-2-[[5-(diazenylmethyl)pyridine-2-carbonyl]amino]propanoyl]piperidin-4-yl]oxyacetic acid (PubChem CID 54419296) has the molecular formula C17H23N5O5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[1-[(2S)-2-[[5-(diazenylmethyl)pyridine-2-carbonyl]amino]propanoyl]piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-[(2S)-2-[[5-(diazenylmethyl)pyridine-2-carbonyl]amino]propanoyl]piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 54419296 |
| Molecular Formula | C17H23N5O5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-[1-[(2S)-2-[[5-(diazenylmethyl)pyridine-2-carbonyl]amino]propanoyl]piperidin-4-yl]oxyacetic acid |
| SMILES | [H]/N=N/Cc1ccc(C(=O)N[C@@H](C)C(=O)N2CCC(OCC(=O)O)CC2)nc1 |
| InChI | InChI=1S/C17H23N5O5/c1-11(21-16(25)14-3-2-12(8-19-14)9-20-18)17(26)22-6-4-13(5-7-22)27-10-15(23)24/h2-3,8,11,13,18H,4-7,9-10H2,1H3,(H,21,25)(H,23,24)/b20-18+/t11-/m0/s1 |
| InChIKey | VZQXZZCWEWAHHC-YYJQLICNSA-N |
| XLogP | 0.82 |
| TPSA | 145.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|