C27H33N5O8 — CID 67650785
4-[[5-(1-aminoethoxycarbonyliminomethyl)pyridine-2-carbonyl]amino]-5-(4-methoxyphenyl)-3-oxo-2-piperidin-4-yloxypentanoic acid (PubChem CID 67650785) has the molecular formula C27H33N5O8 and a molecular weight of 555.59 g/mol. Its IUPAC name is 4-[[5-(1-aminoethoxycarbonyliminomethyl)pyridine-2-carbonyl]amino]-5-(4-methoxyphenyl)-3-oxo-2-piperidin-4-yloxypentanoic acid.
| Compound Name | 4-[[5-(1-aminoethoxycarbonyliminomethyl)pyridine-2-carbonyl]amino]-5-(4-methoxyphenyl)-3-oxo-2-piperidin-4-yloxypentanoic acid |
|---|---|
| PubChem CID | 67650785 |
| Molecular Formula | C27H33N5O8 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 4-[[5-(1-aminoethoxycarbonyliminomethyl)pyridine-2-carbonyl]amino]-5-(4-methoxyphenyl)-3-oxo-2-piperidin-4-yloxypentanoic acid |
| SMILES | COc1ccc(CC(NC(=O)c2ccc(C=NC(=O)OC(C)N)cn2)C(=O)C(OC2CCNCC2)C(=O)O)cc1 |
| InChI | InChI=1S/C27H33N5O8/c1-16(28)39-27(37)31-15-18-5-8-21(30-14-18)25(34)32-22(13-17-3-6-19(38-2)7-4-17)23(33)24(26(35)36)40-20-9-11-29-12-10-20/h3-8,14-16,20,22,24,29H,9-13,28H2,1-2H3,(H,32,34)(H,35,36) |
| InChIKey | DWQMQRUVGCBZEW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 191.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|