C25H30N4O6 — CID 18925439
(2-piperidin-4-yloxyacetyl) 2-[(4-carbamimidoylbenzoyl)amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 18925439) has the molecular formula C25H30N4O6 and a molecular weight of 482.54 g/mol. Its IUPAC name is (2-piperidin-4-yloxyacetyl) 2-[(4-carbamimidoylbenzoyl)amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | (2-piperidin-4-yloxyacetyl) 2-[(4-carbamimidoylbenzoyl)amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 18925439 |
| Molecular Formula | C25H30N4O6 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (2-piperidin-4-yloxyacetyl) 2-[(4-carbamimidoylbenzoyl)amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NC(Cc2ccc(OC)cc2)C(=O)OC(=O)COC2CCNCC2)cc1 |
| InChI | InChI=1S/C25H30N4O6/c1-33-19-8-2-16(3-9-19)14-21(29-24(31)18-6-4-17(5-7-18)23(26)27)25(32)35-22(30)15-34-20-10-12-28-13-11-20/h2-9,20-21,28H,10-15H2,1H3,(H3,26,27)(H,29,31) |
| InChIKey | XIOCAAHBTWOZLX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 152.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|