C19H21N3O7 — CID 70050016
(2R)-2-[(4-carbamimidoylbenzoyl)amino]-3-[4-(carboxymethoxy)phenyl]propanoic acid;hydrate (PubChem CID 70050016) has the molecular formula C19H21N3O7 and a molecular weight of 403.39 g/mol. Its IUPAC name is (2R)-2-[(4-carbamimidoylbenzoyl)amino]-3-[4-(carboxymethoxy)phenyl]propanoic acid;hydrate.
| Compound Name | (2R)-2-[(4-carbamimidoylbenzoyl)amino]-3-[4-(carboxymethoxy)phenyl]propanoic acid;hydrate |
|---|---|
| PubChem CID | 70050016 |
| Molecular Formula | C19H21N3O7 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (2R)-2-[(4-carbamimidoylbenzoyl)amino]-3-[4-(carboxymethoxy)phenyl]propanoic acid;hydrate |
| SMILES | O.[H]/N=C(\N)c1ccc(C(=O)N[C@H](Cc2ccc(OCC(=O)O)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H19N3O6.H2O/c20-17(21)12-3-5-13(6-4-12)18(25)22-15(19(26)27)9-11-1-7-14(8-2-11)28-10-16(23)24;/h1-8,15H,9-10H2,(H3,20,21)(H,22,25)(H,23,24)(H,26,27);1H2/t15-;/m1./s1 |
| InChIKey | IKZWRBOWAJRYKM-XFULWGLBSA-N |
| XLogP | 0.04 |
| TPSA | 194.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|