C25H23N3O5 — CID 67569203
2-[4-[(2S)-2-[(4-methanehydrazonoylbenzoyl)amino]-3-phenylpropanoyl]phenoxy]acetic acid (PubChem CID 67569203) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-[4-[(2S)-2-[(4-methanehydrazonoylbenzoyl)amino]-3-phenylpropanoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(2S)-2-[(4-methanehydrazonoylbenzoyl)amino]-3-phenylpropanoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67569203 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-[4-[(2S)-2-[(4-methanehydrazonoylbenzoyl)amino]-3-phenylpropanoyl]phenoxy]acetic acid |
| SMILES | NN=Cc1ccc(C(=O)N[C@@H](Cc2ccccc2)C(=O)c2ccc(OCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H23N3O5/c26-27-15-18-6-8-20(9-7-18)25(32)28-22(14-17-4-2-1-3-5-17)24(31)19-10-12-21(13-11-19)33-16-23(29)30/h1-13,15,22H,14,16,26H2,(H,28,32)(H,29,30)/t22-/m0/s1 |
| InChIKey | LONWZJXYGRSYRZ-QFIPXVFZSA-N |
| XLogP | 2.67 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|