C21H18F3N3O7 — CID 142661754
[2-[4-[(2S)-2-[[4-[(E)-hydrazinylidenemethyl]benzoyl]amino]-3-hydroxypropanoyl]phenoxy]acetyl] 2,2,2-trifluoroacetate (PubChem CID 142661754) has the molecular formula C21H18F3N3O7 and a molecular weight of 481.38 g/mol. Its IUPAC name is [2-[4-[(2S)-2-[[4-[(E)-hydrazinylidenemethyl]benzoyl]amino]-3-hydroxypropanoyl]phenoxy]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[4-[(2S)-2-[[4-[(E)-hydrazinylidenemethyl]benzoyl]amino]-3-hydroxypropanoyl]phenoxy]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 142661754 |
| Molecular Formula | C21H18F3N3O7 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | [2-[4-[(2S)-2-[[4-[(E)-hydrazinylidenemethyl]benzoyl]amino]-3-hydroxypropanoyl]phenoxy]acetyl] 2,2,2-trifluoroacetate |
| SMILES | N/N=C/c1ccc(C(=O)N[C@@H](CO)C(=O)c2ccc(OCC(=O)OC(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H18F3N3O7/c22-21(23,24)20(32)34-17(29)11-33-15-7-5-13(6-8-15)18(30)16(10-28)27-19(31)14-3-1-12(2-4-14)9-26-25/h1-9,16,28H,10-11,25H2,(H,27,31)/b26-9+/t16-/m0/s1 |
| InChIKey | AZZBZHLSIRDBBE-LZPWANIMSA-N |
| XLogP | 0.96 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|