C19H19N3O5 — CID 67569316
2-[4-[[(2R)-1-(4-methanehydrazonoylphenyl)-1-oxopropan-2-yl]carbamoyl]phenoxy]acetic acid (PubChem CID 67569316) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-[4-[[(2R)-1-(4-methanehydrazonoylphenyl)-1-oxopropan-2-yl]carbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[(2R)-1-(4-methanehydrazonoylphenyl)-1-oxopropan-2-yl]carbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67569316 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-[4-[[(2R)-1-(4-methanehydrazonoylphenyl)-1-oxopropan-2-yl]carbamoyl]phenoxy]acetic acid |
| SMILES | C[C@@H](NC(=O)c1ccc(OCC(=O)O)cc1)C(=O)c1ccc(C=NN)cc1 |
| InChI | InChI=1S/C19H19N3O5/c1-12(18(25)14-4-2-13(3-5-14)10-21-20)22-19(26)15-6-8-16(9-7-15)27-11-17(23)24/h2-10,12H,11,20H2,1H3,(H,22,26)(H,23,24)/t12-/m1/s1 |
| InChIKey | KBGLNVWOJIFCIE-GFCCVEGCSA-N |
| XLogP | 1.44 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|