C20H20N2O5S — CID 67569963
2-[4-[(2S)-2-[[4-(C-methylsulfanylcarbonimidoyl)benzoyl]amino]propanoyl]phenoxy]acetic acid (PubChem CID 67569963) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-[4-[(2S)-2-[[4-(C-methylsulfanylcarbonimidoyl)benzoyl]amino]propanoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(2S)-2-[[4-(C-methylsulfanylcarbonimidoyl)benzoyl]amino]propanoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67569963 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-[4-[(2S)-2-[[4-(C-methylsulfanylcarbonimidoyl)benzoyl]amino]propanoyl]phenoxy]acetic acid |
| SMILES | [H]/N=C(\SC)c1ccc(C(=O)N[C@@H](C)C(=O)c2ccc(OCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O5S/c1-12(18(25)13-7-9-16(10-8-13)27-11-17(23)24)22-20(26)15-5-3-14(4-6-15)19(21)28-2/h3-10,12,21H,11H2,1-2H3,(H,22,26)(H,23,24)/b21-19-/t12-/m0/s1 |
| InChIKey | ZDFYQKHLGKNAPV-UICJJRBLSA-N |
| XLogP | 2.84 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|