C16H22N4O5 — CID 67715600
2-[3-[2-[(4-methanehydrazonoylbenzoyl)amino]propanoylamino]propoxy]acetic acid (PubChem CID 67715600) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-[3-[2-[(4-methanehydrazonoylbenzoyl)amino]propanoylamino]propoxy]acetic acid.
| Compound Name | 2-[3-[2-[(4-methanehydrazonoylbenzoyl)amino]propanoylamino]propoxy]acetic acid |
|---|---|
| PubChem CID | 67715600 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-[3-[2-[(4-methanehydrazonoylbenzoyl)amino]propanoylamino]propoxy]acetic acid |
| SMILES | CC(NC(=O)c1ccc(C=NN)cc1)C(=O)NCCCOCC(=O)O |
| InChI | InChI=1S/C16H22N4O5/c1-11(15(23)18-7-2-8-25-10-14(21)22)20-16(24)13-5-3-12(4-6-13)9-19-17/h3-6,9,11H,2,7-8,10,17H2,1H3,(H,18,23)(H,20,24)(H,21,22) |
| InChIKey | ZRXLWOWZMXDRDC-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|