C26H26ClN3O6 — CID 67569303
2-[4-[(2S)-2-[(4-methanehydrazonoylbenzoyl)amino]-3-(4-methoxyphenyl)propanoyl]phenoxy]acetic acid;hydrochloride (PubChem CID 67569303) has the molecular formula C26H26ClN3O6 and a molecular weight of 511.96 g/mol. Its IUPAC name is 2-[4-[(2S)-2-[(4-methanehydrazonoylbenzoyl)amino]-3-(4-methoxyphenyl)propanoyl]phenoxy]acetic acid;hydrochloride.
| Compound Name | 2-[4-[(2S)-2-[(4-methanehydrazonoylbenzoyl)amino]-3-(4-methoxyphenyl)propanoyl]phenoxy]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 67569303 |
| Molecular Formula | C26H26ClN3O6 |
| Molecular Weight | 511.96 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 2-[4-[(2S)-2-[(4-methanehydrazonoylbenzoyl)amino]-3-(4-methoxyphenyl)propanoyl]phenoxy]acetic acid;hydrochloride |
| SMILES | COc1ccc(C[C@H](NC(=O)c2ccc(C=NN)cc2)C(=O)c2ccc(OCC(=O)O)cc2)cc1.Cl |
| InChI | InChI=1S/C26H25N3O6.ClH/c1-34-21-10-4-17(5-11-21)14-23(29-26(33)20-6-2-18(3-7-20)15-28-27)25(32)19-8-12-22(13-9-19)35-16-24(30)31;/h2-13,15,23H,14,16,27H2,1H3,(H,29,33)(H,30,31);1H/t23-;/m0./s1 |
| InChIKey | UFLKGZIILQVDIK-BQAIUKQQSA-N |
| XLogP | 3.10 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.96 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|