C33H37N3O9 — CID 67570076
2-[4-[(2S)-3-[4-(2-methoxyethoxy)phenyl]-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]benzoyl]amino]propanoyl]phenoxy]acetic acid (PubChem CID 67570076) has the molecular formula C33H37N3O9 and a molecular weight of 619.67 g/mol. Its IUPAC name is 2-[4-[(2S)-3-[4-(2-methoxyethoxy)phenyl]-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]benzoyl]amino]propanoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(2S)-3-[4-(2-methoxyethoxy)phenyl]-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]benzoyl]amino]propanoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67570076 |
| Molecular Formula | C33H37N3O9 |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | 2-[4-[(2S)-3-[4-(2-methoxyethoxy)phenyl]-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]benzoyl]amino]propanoyl]phenoxy]acetic acid |
| SMILES | COCCOc1ccc(C[C@H](NC(=O)c2ccc(C=NNC(=O)OC(C)(C)C)cc2)C(=O)c2ccc(OCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C33H37N3O9/c1-33(2,3)45-32(41)36-34-20-23-5-9-25(10-6-23)31(40)35-28(19-22-7-13-26(14-8-22)43-18-17-42-4)30(39)24-11-15-27(16-12-24)44-21-29(37)38/h5-16,20,28H,17-19,21H2,1-4H3,(H,35,40)(H,36,41)(H,37,38)/t28-/m0/s1 |
| InChIKey | OVEZMDKJZPJEGQ-NDEPHWFRSA-N |
| XLogP | 4.26 |
| TPSA | 161.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|