C19H30N2O6 — CID 86754680
tert-butyl N-[(2S)-3-[4-(2-methoxyethoxy)phenyl]-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate (PubChem CID 86754680) has the molecular formula C19H30N2O6 and a molecular weight of 382.46 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-[4-(2-methoxyethoxy)phenyl]-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-[4-(2-methoxyethoxy)phenyl]-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 86754680 |
| Molecular Formula | C19H30N2O6 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | tert-butyl N-[(2S)-3-[4-(2-methoxyethoxy)phenyl]-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate |
| SMILES | COCCOc1ccc(C[C@H](NC(=O)OC(C)(C)C)C(=O)N(C)OC)cc1 |
| InChI | InChI=1S/C19H30N2O6/c1-19(2,3)27-18(23)20-16(17(22)21(4)25-6)13-14-7-9-15(10-8-14)26-12-11-24-5/h7-10,16H,11-13H2,1-6H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | NOPBSBKGQYONMH-INIZCTEOSA-N |
| XLogP | 2.17 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|