C17H13F3N2O5 — CID 45109462
2-[4-[(E)-[[4-(trifluoromethoxy)benzoyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 45109462) has the molecular formula C17H13F3N2O5 and a molecular weight of 382.29 g/mol. Its IUPAC name is 2-[4-[(E)-[[4-(trifluoromethoxy)benzoyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[[4-(trifluoromethoxy)benzoyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 45109462 |
| Molecular Formula | C17H13F3N2O5 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-[4-[(E)-[[4-(trifluoromethoxy)benzoyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=N/NC(=O)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H13F3N2O5/c18-17(19,20)27-14-7-3-12(4-8-14)16(25)22-21-9-11-1-5-13(6-2-11)26-10-15(23)24/h1-9H,10H2,(H,22,25)(H,23,24)/b21-9+ |
| InChIKey | QVTFASLBKCHEEU-ZVBGSRNCSA-N |
| XLogP | 2.81 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|