C16H14FN3O3 — CID 96885337
N-[(E)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-4-fluorobenzamide (PubChem CID 96885337) has the molecular formula C16H14FN3O3 and a molecular weight of 315.30 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-4-fluorobenzamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 96885337 |
| Molecular Formula | C16H14FN3O3 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-4-fluorobenzamide |
| SMILES | NC(=O)COc1ccc(/C=N/NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H14FN3O3/c17-13-5-3-12(4-6-13)16(22)20-19-9-11-1-7-14(8-2-11)23-10-15(18)21/h1-9H,10H2,(H2,18,21)(H,20,22)/b19-9+ |
| InChIKey | DHSWRPZDLPQKIB-DJKKODMXSA-N |
| XLogP | 1.45 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|