C21H25N4O4+ — CID 6966568
N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-4-(morpholin-4-ium-4-ylmethyl)benzamide (PubChem CID 6966568) has the molecular formula C21H25N4O4+ and a molecular weight of 397.46 g/mol. Its IUPAC name is N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-4-(morpholin-4-ium-4-ylmethyl)benzamide.
| Compound Name | N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-4-(morpholin-4-ium-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 6966568 |
| Molecular Formula | C21H25N4O4+ |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-4-(morpholin-4-ium-4-ylmethyl)benzamide |
| SMILES | NC(=O)COc1ccc(/C=N\NC(=O)c2ccc(C[NH+]3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C21H24N4O4/c22-20(26)15-29-19-7-3-16(4-8-19)13-23-24-21(27)18-5-1-17(2-6-18)14-25-9-11-28-12-10-25/h1-8,13H,9-12,14-15H2,(H2,22,26)(H,24,27)/p+1/b23-13- |
| InChIKey | XVXKJMMQCHSHEC-QRVIBDJDSA-O |
| XLogP | -0.27 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|