C19H21N3O3 — CID 3265840
4-(2-amino-2-oxoethoxy)-N-[(2,4,6-trimethylphenyl)methylideneamino]benzamide (PubChem CID 3265840) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[(2,4,6-trimethylphenyl)methylideneamino]benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[(2,4,6-trimethylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 3265840 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[(2,4,6-trimethylphenyl)methylideneamino]benzamide |
| SMILES | Cc1cc(C)c(C=NNC(=O)c2ccc(OCC(N)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C19H21N3O3/c1-12-8-13(2)17(14(3)9-12)10-21-22-19(24)15-4-6-16(7-5-15)25-11-18(20)23/h4-10H,11H2,1-3H3,(H2,20,23)(H,22,24) |
| InChIKey | UAVUUGYXXHBHIY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|