C25H25N3O2 — CID 3376592
2-methyl-N-[4-[[(2,4,6-trimethylphenyl)methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 3376592) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-methyl-N-[4-[[(2,4,6-trimethylphenyl)methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 2-methyl-N-[4-[[(2,4,6-trimethylphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3376592 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-methyl-N-[4-[[(2,4,6-trimethylphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | Cc1cc(C)c(C=NNC(=O)c2ccc(NC(=O)c3ccccc3C)cc2)c(C)c1 |
| InChI | InChI=1S/C25H25N3O2/c1-16-13-18(3)23(19(4)14-16)15-26-28-24(29)20-9-11-21(12-10-20)27-25(30)22-8-6-5-7-17(22)2/h5-15H,1-4H3,(H,27,30)(H,28,29) |
| InChIKey | YFUIBSCFBSAQEK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|