C23H22N2O — CID 6132987
4-phenyl-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]benzamide (PubChem CID 6132987) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-phenyl-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]benzamide.
| Compound Name | 4-phenyl-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6132987 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 4-phenyl-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]benzamide |
| SMILES | Cc1cc(C)c(/C=N\NC(=O)c2ccc(-c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H22N2O/c1-16-13-17(2)22(18(3)14-16)15-24-25-23(26)21-11-9-20(10-12-21)19-7-5-4-6-8-19/h4-15H,1-3H3,(H,25,26)/b24-15- |
| InChIKey | GWJYYOLIEXKSBQ-IWIPYMOSSA-N |
| XLogP | 5.04 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|