C20H30N4O5 — CID 86748358
butyl 2-[3-[[(2S)-2-[(4-methanehydrazonoylbenzoyl)amino]propanoyl]amino]propoxy]acetate (PubChem CID 86748358) has the molecular formula C20H30N4O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is butyl 2-[3-[[(2S)-2-[(4-methanehydrazonoylbenzoyl)amino]propanoyl]amino]propoxy]acetate.
| Compound Name | butyl 2-[3-[[(2S)-2-[(4-methanehydrazonoylbenzoyl)amino]propanoyl]amino]propoxy]acetate |
|---|---|
| PubChem CID | 86748358 |
| Molecular Formula | C20H30N4O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | butyl 2-[3-[[(2S)-2-[(4-methanehydrazonoylbenzoyl)amino]propanoyl]amino]propoxy]acetate |
| SMILES | CCCCOC(=O)COCCCNC(=O)[C@H](C)NC(=O)c1ccc(C=NN)cc1 |
| InChI | InChI=1S/C20H30N4O5/c1-3-4-12-29-18(25)14-28-11-5-10-22-19(26)15(2)24-20(27)17-8-6-16(7-9-17)13-23-21/h6-9,13,15H,3-5,10-12,14,21H2,1-2H3,(H,22,26)(H,24,27)/t15-/m0/s1 |
| InChIKey | RXJQPQBZVLJKKO-HNNXBMFYSA-N |
| XLogP | 0.96 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|