C25H35N3O3 — CID 142639027
4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N,N-dipropylbenzamide (PubChem CID 142639027) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is 4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N,N-dipropylbenzamide.
| Compound Name | 4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 142639027 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(OCCCCCOc2ccc(C=NN)cc2)cc1 |
| InChI | InChI=1S/C25H35N3O3/c1-3-16-28(17-4-2)25(29)22-10-14-24(15-11-22)31-19-7-5-6-18-30-23-12-8-21(9-13-23)20-27-26/h8-15,20H,3-7,16-19,26H2,1-2H3 |
| InChIKey | KTYSFNTUPNAUPA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|