C25H35BrClN3O3 — CID 139616749
2-bromo-4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N,N-di(propan-2-yl)benzamide;hydrochloride (PubChem CID 139616749) has the molecular formula C25H35BrClN3O3 and a molecular weight of 540.93 g/mol. Its IUPAC name is 2-bromo-4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N,N-di(propan-2-yl)benzamide;hydrochloride.
| Compound Name | 2-bromo-4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N,N-di(propan-2-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 139616749 |
| Molecular Formula | C25H35BrClN3O3 |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-bromo-4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N,N-di(propan-2-yl)benzamide;hydrochloride |
| SMILES | CC(C)N(C(=O)c1ccc(OCCCCCOc2ccc(C=NN)cc2)cc1Br)C(C)C.Cl |
| InChI | InChI=1S/C25H34BrN3O3.ClH/c1-18(2)29(19(3)4)25(30)23-13-12-22(16-24(23)26)32-15-7-5-6-14-31-21-10-8-20(9-11-21)17-28-27;/h8-13,16-19H,5-7,14-15,27H2,1-4H3;1H |
| InChIKey | CHBYYIRTLHYWSI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|