C27H40ClN3O5 — CID 67744792
4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-2,3-dimethoxy-N,N-di(propan-2-yl)benzamide;hydrochloride (PubChem CID 67744792) has the molecular formula C27H40ClN3O5 and a molecular weight of 522.09 g/mol. Its IUPAC name is 4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-2,3-dimethoxy-N,N-di(propan-2-yl)benzamide;hydrochloride.
| Compound Name | 4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-2,3-dimethoxy-N,N-di(propan-2-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 67744792 |
| Molecular Formula | C27H40ClN3O5 |
| Molecular Weight | 522.09 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | 4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-2,3-dimethoxy-N,N-di(propan-2-yl)benzamide;hydrochloride |
| SMILES | COc1c(OCCCCCOc2ccc(C=NN)cc2)ccc(C(=O)N(C(C)C)C(C)C)c1OC.Cl |
| InChI | InChI=1S/C27H39N3O5.ClH/c1-19(2)30(20(3)4)27(31)23-14-15-24(26(33-6)25(23)32-5)35-17-9-7-8-16-34-22-12-10-21(11-13-22)18-29-28;/h10-15,18-20H,7-9,16-17,28H2,1-6H3;1H |
| InChIKey | IDJIOXRLIMEBSM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.09 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|