C24H33N3O4 — CID 67744802
N,N-diethyl-4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-3-methoxybenzamide (PubChem CID 67744802) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is N,N-diethyl-4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-3-methoxybenzamide.
| Compound Name | N,N-diethyl-4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-3-methoxybenzamide |
|---|---|
| PubChem CID | 67744802 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | N,N-diethyl-4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-3-methoxybenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(OCCCCCOc2ccc(C=NN)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H33N3O4/c1-4-27(5-2)24(28)20-11-14-22(23(17-20)29-3)31-16-8-6-7-15-30-21-12-9-19(10-13-21)18-26-25/h9-14,17-18H,4-8,15-16,25H2,1-3H3 |
| InChIKey | KJTXVIVHUMYCJV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|