C23H31NO4 — CID 142639008
4-[5-(4-ethylphenoxy)pentoxy]-3-methoxy-N,N-dimethylbenzamide (PubChem CID 142639008) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 4-[5-(4-ethylphenoxy)pentoxy]-3-methoxy-N,N-dimethylbenzamide.
| Compound Name | 4-[5-(4-ethylphenoxy)pentoxy]-3-methoxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 142639008 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 4-[5-(4-ethylphenoxy)pentoxy]-3-methoxy-N,N-dimethylbenzamide |
| SMILES | CCc1ccc(OCCCCCOc2ccc(C(=O)N(C)C)cc2OC)cc1 |
| InChI | InChI=1S/C23H31NO4/c1-5-18-9-12-20(13-10-18)27-15-7-6-8-16-28-21-14-11-19(17-22(21)26-4)23(25)24(2)3/h9-14,17H,5-8,15-16H2,1-4H3 |
| InChIKey | NBMRYSSPDFNZHQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|