C24H33N3O4 — CID 15340521
4-[5-(4-carbamimidoylphenoxy)pentoxy]-N,N-diethyl-3-methoxybenzamide (PubChem CID 15340521) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-[5-(4-carbamimidoylphenoxy)pentoxy]-N,N-diethyl-3-methoxybenzamide.
| Compound Name | 4-[5-(4-carbamimidoylphenoxy)pentoxy]-N,N-diethyl-3-methoxybenzamide |
|---|---|
| PubChem CID | 15340521 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 4-[5-(4-carbamimidoylphenoxy)pentoxy]-N,N-diethyl-3-methoxybenzamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCCCCOc2ccc(C(=O)N(CC)CC)cc2OC)cc1 |
| InChI | InChI=1S/C24H33N3O4/c1-4-27(5-2)24(28)19-11-14-21(22(17-19)29-3)31-16-8-6-7-15-30-20-12-9-18(10-13-20)23(25)26/h9-14,17H,4-8,15-16H2,1-3H3,(H3,25,26) |
| InChIKey | LPQRSFJPNIBZST-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|