C28H43N3O8S — CID 18991679
4-[5-(4-carbamimidoylphenoxy)pentoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide;2-hydroxyethanesulfonic acid (PubChem CID 18991679) has the molecular formula C28H43N3O8S and a molecular weight of 581.73 g/mol. Its IUPAC name is 4-[5-(4-carbamimidoylphenoxy)pentoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide;2-hydroxyethanesulfonic acid.
| Compound Name | 4-[5-(4-carbamimidoylphenoxy)pentoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide;2-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 18991679 |
| Molecular Formula | C28H43N3O8S |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 4-[5-(4-carbamimidoylphenoxy)pentoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide;2-hydroxyethanesulfonic acid |
| SMILES | O=S(=O)(O)CCO.[H]/N=C(\N)c1ccc(OCCCCCOc2ccc(C(=O)N(C(C)C)C(C)C)cc2OC)cc1 |
| InChI | InChI=1S/C26H37N3O4.C2H6O4S/c1-18(2)29(19(3)4)26(30)21-11-14-23(24(17-21)31-5)33-16-8-6-7-15-32-22-12-9-20(10-13-22)25(27)28;3-1-2-7(4,5)6/h9-14,17-19H,6-8,15-16H2,1-5H3,(H3,27,28);3H,1-2H2,(H,4,5,6) |
| InChIKey | DTWMBOXNDHAVJB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 172.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|