C28H40N2O5 — CID 18991650
ethyl 4-[5-[4-[di(propan-2-yl)carbamoyl]phenoxy]pentoxy]-2-methoxybenzenecarboximidate (PubChem CID 18991650) has the molecular formula C28H40N2O5 and a molecular weight of 484.64 g/mol. Its IUPAC name is ethyl 4-[5-[4-[di(propan-2-yl)carbamoyl]phenoxy]pentoxy]-2-methoxybenzenecarboximidate.
| Compound Name | ethyl 4-[5-[4-[di(propan-2-yl)carbamoyl]phenoxy]pentoxy]-2-methoxybenzenecarboximidate |
|---|---|
| PubChem CID | 18991650 |
| Molecular Formula | C28H40N2O5 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | ethyl 4-[5-[4-[di(propan-2-yl)carbamoyl]phenoxy]pentoxy]-2-methoxybenzenecarboximidate |
| SMILES | [H]/N=C(\OCC)c1ccc(OCCCCCOc2ccc(C(=O)N(C(C)C)C(C)C)cc2)cc1OC |
| InChI | InChI=1S/C28H40N2O5/c1-7-33-27(29)25-16-15-24(19-26(25)32-6)35-18-10-8-9-17-34-23-13-11-22(12-14-23)28(31)30(20(2)3)21(4)5/h11-16,19-21,29H,7-10,17-18H2,1-6H3/b29-27- |
| InChIKey | MRIJLNPONMFXJP-OHYPFYFLSA-N |
| XLogP | 5.94 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|