C11H16ClNO3 — CID 22721088
ethyl 2,4-dimethoxybenzenecarboximidate;hydrochloride (PubChem CID 22721088) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is ethyl 2,4-dimethoxybenzenecarboximidate;hydrochloride.
| Compound Name | ethyl 2,4-dimethoxybenzenecarboximidate;hydrochloride |
|---|---|
| PubChem CID | 22721088 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | ethyl 2,4-dimethoxybenzenecarboximidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\OCC)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C11H15NO3.ClH/c1-4-15-11(12)9-6-5-8(13-2)7-10(9)14-3;/h5-7,12H,4H2,1-3H3;1H/b12-11-; |
| InChIKey | ZMCCRKSMYCQXQK-AFEZEDKISA-N |
| XLogP | 2.49 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|