C9H12N2O2 — CID 4138242
2,4-dimethoxybenzenecarboximidamide (PubChem CID 4138242) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2,4-dimethoxybenzenecarboximidamide.
| Compound Name | 2,4-dimethoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 4138242 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2,4-dimethoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C9H12N2O2/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3,(H3,10,11) |
| InChIKey | OHDVRMGJIHLLMB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|