C9H12ClNO3 — CID 139034333
ethyl 2,4-dihydroxybenzenecarboximidate;hydrochloride (PubChem CID 139034333) has the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. Its IUPAC name is ethyl 2,4-dihydroxybenzenecarboximidate;hydrochloride.
| Compound Name | ethyl 2,4-dihydroxybenzenecarboximidate;hydrochloride |
|---|---|
| PubChem CID | 139034333 |
| Molecular Formula | C9H12ClNO3 |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | ethyl 2,4-dihydroxybenzenecarboximidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\OCC)c1ccc(O)cc1O |
| InChI | InChI=1S/C9H11NO3.ClH/c1-2-13-9(10)7-4-3-6(11)5-8(7)12;/h3-5,10-12H,2H2,1H3;1H/b10-9-; |
| InChIKey | VHWWFRGRSKNJGK-KVVVOXFISA-N |
| XLogP | 1.88 |
| TPSA | 73.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|