C17H16ClNO6 — CID 137187105
[3-acetyloxy-4-(2,4-dihydroxybenzenecarboximidoyl)phenyl] acetate;hydrochloride (PubChem CID 137187105) has the molecular formula C17H16ClNO6 and a molecular weight of 365.77 g/mol. Its IUPAC name is [3-acetyloxy-4-(2,4-dihydroxybenzenecarboximidoyl)phenyl] acetate;hydrochloride.
| Compound Name | [3-acetyloxy-4-(2,4-dihydroxybenzenecarboximidoyl)phenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 137187105 |
| Molecular Formula | C17H16ClNO6 |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | [3-acetyloxy-4-(2,4-dihydroxybenzenecarboximidoyl)phenyl] acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\c1ccc(O)cc1O)c1ccc(OC(C)=O)cc1OC(C)=O |
| InChI | InChI=1S/C17H15NO6.ClH/c1-9(19)23-12-4-6-14(16(8-12)24-10(2)20)17(18)13-5-3-11(21)7-15(13)22;/h3-8,18,21-22H,1-2H3;1H/b18-17+; |
| InChIKey | RIBYYPHGZLIVHZ-ZAGWXBKKSA-N |
| XLogP | 2.79 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|