C14H14O8 — CID 15689628
(3,4,5-triacetyloxyphenyl) acetate (PubChem CID 15689628) has the molecular formula C14H14O8 and a molecular weight of 310.26 g/mol. Its IUPAC name is (3,4,5-triacetyloxyphenyl) acetate.
| Compound Name | (3,4,5-triacetyloxyphenyl) acetate |
|---|---|
| PubChem CID | 15689628 |
| Molecular Formula | C14H14O8 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | (3,4,5-triacetyloxyphenyl) acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)c(OC(C)=O)c(OC(C)=O)c1 |
| InChI | InChI=1S/C14H14O8/c1-7(15)19-11-5-12(20-8(2)16)14(22-10(4)18)13(6-11)21-9(3)17/h5-6H,1-4H3 |
| InChIKey | ITTQHEDAARBBGF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|