C24H22O10 — CID 77188815
[3-acetyloxy-5-[2-(3,4,5-triacetyloxyphenyl)ethenyl]phenyl] acetate (PubChem CID 77188815) has the molecular formula C24H22O10 and a molecular weight of 470.43 g/mol. Its IUPAC name is [3-acetyloxy-5-[2-(3,4,5-triacetyloxyphenyl)ethenyl]phenyl] acetate.
| Compound Name | [3-acetyloxy-5-[2-(3,4,5-triacetyloxyphenyl)ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 77188815 |
| Molecular Formula | C24H22O10 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | [3-acetyloxy-5-[2-(3,4,5-triacetyloxyphenyl)ethenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(C=Cc2cc(OC(C)=O)c(OC(C)=O)c(OC(C)=O)c2)cc(OC(C)=O)c1 |
| InChI | InChI=1S/C24H22O10/c1-13(25)30-20-8-18(9-21(12-20)31-14(2)26)6-7-19-10-22(32-15(3)27)24(34-17(5)29)23(11-19)33-16(4)28/h6-12H,1-5H3 |
| InChIKey | FSODBKNZABNTHI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|