C15H14O8 — CID 154640312
(Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid (PubChem CID 154640312) has the molecular formula C15H14O8 and a molecular weight of 322.27 g/mol. Its IUPAC name is (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 154640312 |
| Molecular Formula | C15H14O8 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid |
| SMILES | CC(=O)Oc1cc(/C=C\C(=O)O)cc(OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C15H14O8/c1-8(16)21-12-6-11(4-5-14(19)20)7-13(22-9(2)17)15(12)23-10(3)18/h4-7H,1-3H3,(H,19,20)/b5-4- |
| InChIKey | GEQSVAGUQYLPCS-PLNGDYQASA-N |
| XLogP | 1.56 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|