(Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid

C15H14O8 — CID 154640312

IUPAC(Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid
SMILESCC(=O)Oc1cc(/C=C\C(=O)O)cc(OC(C)=O)c1OC(C)=O
InChIInChI=1S/C15H14O8/c1-8(16)21-12-6-11(4-5-14(19)20)7-13(22-9(2)17)15(12)23-10(3)18/h4-7H,1-3H3,(H,19,20)/b5-4-
InChIKeyGEQSVAGUQYLPCS-PLNGDYQASA-N
MW322.27 g/mol
LogP1.56
Rot. Bonds5

About (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid

(Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid (PubChem CID 154640312) has the molecular formula C15H14O8 and a molecular weight of 322.27 g/mol. Its IUPAC name is (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid.

Molecular Properties

Compound Name(Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid
PubChem CID154640312
Molecular FormulaC15H14O8
Molecular Weight322.27 g/mol
Exact Mass322.07
IUPAC Name(Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid
SMILESCC(=O)Oc1cc(/C=C\C(=O)O)cc(OC(C)=O)c1OC(C)=O
InChIInChI=1S/C15H14O8/c1-8(16)21-12-6-11(4-5-14(19)20)7-13(22-9(2)17)15(12)23-10(3)18/h4-7H,1-3H3,(H,19,20)/b5-4-
InChIKeyGEQSVAGUQYLPCS-PLNGDYQASA-N
XLogP1.56
TPSA116.20 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.27
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid?
The IUPAC name of (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid (CID 154640312) is (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid.
What is the SMILES notation for (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid?
The canonical SMILES for (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid is CC(=O)Oc1cc(/C=C\C(=O)O)cc(OC(C)=O)c1OC(C)=O.
What is the InChIKey of (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid?
The InChIKey is GEQSVAGUQYLPCS-PLNGDYQASA-N. The full InChI is InChI=1S/C15H14O8/c1-8(16)21-12-6-11(4-5-14(19)20)7-13(22-9(2)17)15(12)23-10(3)18/h4-7H,1-3H3,(H,19,20)/b5-4-.
What are the key properties of (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid?
(Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid has a molecular weight of 322.27 g/mol, XLogP of 1.56, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(3,4,5-triacetyloxyphenyl)prop-2-enoic acid is sourced from PubChem (CID 154640312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).