C17H23NO5 — CID 123248209
[4-[3-(diethylamino)-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 123248209) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is [4-[3-(diethylamino)-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[3-(diethylamino)-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 123248209 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | [4-[3-(diethylamino)-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | CCN(CC)C(=O)C=Cc1cc(OC)c(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C17H23NO5/c1-6-18(7-2)16(20)9-8-13-10-14(21-4)17(23-12(3)19)15(11-13)22-5/h8-11H,6-7H2,1-5H3 |
| InChIKey | PJDIPXTZRBGETC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|