C26H27NO4 — CID 76857554
N,N-dibenzyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 76857554) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is N,N-dibenzyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | N,N-dibenzyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 76857554 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N,N-dibenzyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)N(Cc2ccccc2)Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H27NO4/c1-29-23-16-22(17-24(30-2)26(23)31-3)14-15-25(28)27(18-20-10-6-4-7-11-20)19-21-12-8-5-9-13-21/h4-17H,18-19H2,1-3H3 |
| InChIKey | OATVWNDEGYGLIL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|