C20H23NO3 — CID 6057475
(E)-N-benzyl-3-(3,4-dimethoxyphenyl)-N-ethylprop-2-enamide (PubChem CID 6057475) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (E)-N-benzyl-3-(3,4-dimethoxyphenyl)-N-ethylprop-2-enamide.
| Compound Name | (E)-N-benzyl-3-(3,4-dimethoxyphenyl)-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 6057475 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (E)-N-benzyl-3-(3,4-dimethoxyphenyl)-N-ethylprop-2-enamide |
| SMILES | CCN(Cc1ccccc1)C(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H23NO3/c1-4-21(15-17-8-6-5-7-9-17)20(22)13-11-16-10-12-18(23-2)19(14-16)24-3/h5-14H,4,15H2,1-3H3/b13-11+ |
| InChIKey | JPSHWOJLNKGADD-ACCUITESSA-N |
| XLogP | 3.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|