C19H19F2NO3 — CID 78774345
N-benzyl-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide (PubChem CID 78774345) has the molecular formula C19H19F2NO3 and a molecular weight of 347.36 g/mol. Its IUPAC name is N-benzyl-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide.
| Compound Name | N-benzyl-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 78774345 |
| Molecular Formula | C19H19F2NO3 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-benzyl-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide |
| SMILES | COc1cc(C=CC(=O)N(C)Cc2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C19H19F2NO3/c1-22(13-15-6-4-3-5-7-15)18(23)11-9-14-8-10-16(25-19(20)21)17(12-14)24-2/h3-12,19H,13H2,1-2H3 |
| InChIKey | GJBIUITVXYSSJJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|