C22H25F2NO5 — CID 8960830
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-methylprop-2-enamide (PubChem CID 8960830) has the molecular formula C22H25F2NO5 and a molecular weight of 421.44 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 8960830 |
| Molecular Formula | C22H25F2NO5 |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-methylprop-2-enamide |
| SMILES | CCOc1ccc(CN(C)C(=O)/C=C/c2ccc(OC(F)F)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H25F2NO5/c1-5-29-17-9-7-16(13-19(17)27-3)14-25(2)21(26)11-8-15-6-10-18(30-22(23)24)20(12-15)28-4/h6-13,22H,5,14H2,1-4H3/b11-8+ |
| InChIKey | FARJYYLKTLCISN-DHZHZOJOSA-N |
| XLogP | 4.38 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|