C21H23F2NO3S — CID 30807995
(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-methyl-N-[(4-methylsulfanylphenyl)methyl]prop-2-enamide (PubChem CID 30807995) has the molecular formula C21H23F2NO3S and a molecular weight of 407.48 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-methyl-N-[(4-methylsulfanylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-methyl-N-[(4-methylsulfanylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 30807995 |
| Molecular Formula | C21H23F2NO3S |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-methyl-N-[(4-methylsulfanylphenyl)methyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)N(C)Cc2ccc(SC)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C21H23F2NO3S/c1-4-26-19-13-15(7-11-18(19)27-21(22)23)8-12-20(25)24(2)14-16-5-9-17(28-3)10-6-16/h5-13,21H,4,14H2,1-3H3/b12-8+ |
| InChIKey | TYKGYKIMEYPJFW-XYOKQWHBSA-N |
| XLogP | 5.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|